C28H35F2N3O3 — CID 144791691
4,4-difluoro-N-hydroxy-2,3-dimethyl-2-[3-[4-[2-[4-(morpholin-4-ylmethyl)phenyl]ethynyl]phenyl]propylamino]butanamide (PubChem CID 144791691) has the molecular formula C28H35F2N3O3 and a molecular weight of 499.60 g/mol. Its IUPAC name is 4,4-difluoro-N-hydroxy-2,3-dimethyl-2-[3-[4-[2-[4-(morpholin-4-ylmethyl)phenyl]ethynyl]phenyl]propylamino]butanamide.
| Compound Name | 4,4-difluoro-N-hydroxy-2,3-dimethyl-2-[3-[4-[2-[4-(morpholin-4-ylmethyl)phenyl]ethynyl]phenyl]propylamino]butanamide |
|---|---|
| PubChem CID | 144791691 |
| Molecular Formula | C28H35F2N3O3 |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.26 |
| IUPAC Name | 4,4-difluoro-N-hydroxy-2,3-dimethyl-2-[3-[4-[2-[4-(morpholin-4-ylmethyl)phenyl]ethynyl]phenyl]propylamino]butanamide |
| SMILES | CC(C(F)F)C(C)(NCCCc1ccc(C#Cc2ccc(CN3CCOCC3)cc2)cc1)C(=O)NO |
| InChI | InChI=1S/C28H35F2N3O3/c1-21(26(29)30)28(2,27(34)32-35)31-15-3-4-22-5-7-23(8-6-22)9-10-24-11-13-25(14-12-24)20-33-16-18-36-19-17-33/h5-8,11-14,21,26,31,35H,3-4,15-20H2,1-2H3,(H,32,34) |
| InChIKey | DSPJEYFAUCFEAI-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|