C30H35F2N3O6 — CID 138675299
[[(2S,3S)-4,4-difluoro-3-hydroxy-3-methyl-2-[[4-[2-[4-(morpholin-4-ylmethyl)phenyl]ethynyl]benzoyl]amino]butanoyl]amino] 2,2-dimethylpropanoate (PubChem CID 138675299) has the molecular formula C30H35F2N3O6 and a molecular weight of 571.62 g/mol. Its IUPAC name is [[(2S,3S)-4,4-difluoro-3-hydroxy-3-methyl-2-[[4-[2-[4-(morpholin-4-ylmethyl)phenyl]ethynyl]benzoyl]amino]butanoyl]amino] 2,2-dimethylpropanoate.
| Compound Name | [[(2S,3S)-4,4-difluoro-3-hydroxy-3-methyl-2-[[4-[2-[4-(morpholin-4-ylmethyl)phenyl]ethynyl]benzoyl]amino]butanoyl]amino] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 138675299 |
| Molecular Formula | C30H35F2N3O6 |
| Molecular Weight | 571.62 g/mol |
| Exact Mass | 571.25 |
| IUPAC Name | [[(2S,3S)-4,4-difluoro-3-hydroxy-3-methyl-2-[[4-[2-[4-(morpholin-4-ylmethyl)phenyl]ethynyl]benzoyl]amino]butanoyl]amino] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)ONC(=O)[C@@H](NC(=O)c1ccc(C#Cc2ccc(CN3CCOCC3)cc2)cc1)[C@](C)(O)C(F)F |
| InChI | InChI=1S/C30H35F2N3O6/c1-29(2,3)28(38)41-34-26(37)24(30(4,39)27(31)32)33-25(36)23-13-11-21(12-14-23)6-5-20-7-9-22(10-8-20)19-35-15-17-40-18-16-35/h7-14,24,27,39H,15-19H2,1-4H3,(H,33,36)(H,34,37)/t24-,30+/m1/s1 |
| InChIKey | QTTKFNXHFPYTQE-HLADLETHSA-N |
| XLogP | 2.65 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.62 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|