C26H29F2N3O5 — CID 87072920
N-[4,4-difluoro-1-(hydroxyamino)-3-methoxy-3-methyl-1-oxobutan-2-yl]-4-[2-[4-(morpholin-4-ylmethyl)phenyl]ethynyl]benzamide (PubChem CID 87072920) has the molecular formula C26H29F2N3O5 and a molecular weight of 501.53 g/mol. Its IUPAC name is N-[4,4-difluoro-1-(hydroxyamino)-3-methoxy-3-methyl-1-oxobutan-2-yl]-4-[2-[4-(morpholin-4-ylmethyl)phenyl]ethynyl]benzamide.
| Compound Name | N-[4,4-difluoro-1-(hydroxyamino)-3-methoxy-3-methyl-1-oxobutan-2-yl]-4-[2-[4-(morpholin-4-ylmethyl)phenyl]ethynyl]benzamide |
|---|---|
| PubChem CID | 87072920 |
| Molecular Formula | C26H29F2N3O5 |
| Molecular Weight | 501.53 g/mol |
| Exact Mass | 501.21 |
| IUPAC Name | N-[4,4-difluoro-1-(hydroxyamino)-3-methoxy-3-methyl-1-oxobutan-2-yl]-4-[2-[4-(morpholin-4-ylmethyl)phenyl]ethynyl]benzamide |
| SMILES | COC(C)(C(F)F)C(NC(=O)c1ccc(C#Cc2ccc(CN3CCOCC3)cc2)cc1)C(=O)NO |
| InChI | InChI=1S/C26H29F2N3O5/c1-26(35-2,25(27)28)22(24(33)30-34)29-23(32)21-11-9-19(10-12-21)4-3-18-5-7-20(8-6-18)17-31-13-15-36-16-14-31/h5-12,22,25,34H,13-17H2,1-2H3,(H,29,32)(H,30,33) |
| InChIKey | HKCVHALBVXMYJS-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.53 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|