C23H20F2N2O5 — CID 87084841
N-[(2S)-4,4-difluoro-1-(hydroxyamino)-3-methoxy-3-methyl-1-oxobutan-2-yl]-4-[4-(4-hydroxyphenyl)buta-1,3-diynyl]benzamide (PubChem CID 87084841) has the molecular formula C23H20F2N2O5 and a molecular weight of 442.42 g/mol. Its IUPAC name is N-[(2S)-4,4-difluoro-1-(hydroxyamino)-3-methoxy-3-methyl-1-oxobutan-2-yl]-4-[4-(4-hydroxyphenyl)buta-1,3-diynyl]benzamide.
| Compound Name | N-[(2S)-4,4-difluoro-1-(hydroxyamino)-3-methoxy-3-methyl-1-oxobutan-2-yl]-4-[4-(4-hydroxyphenyl)buta-1,3-diynyl]benzamide |
|---|---|
| PubChem CID | 87084841 |
| Molecular Formula | C23H20F2N2O5 |
| Molecular Weight | 442.42 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | N-[(2S)-4,4-difluoro-1-(hydroxyamino)-3-methoxy-3-methyl-1-oxobutan-2-yl]-4-[4-(4-hydroxyphenyl)buta-1,3-diynyl]benzamide |
| SMILES | COC(C)(C(F)F)[C@H](NC(=O)c1ccc(C#CC#Cc2ccc(O)cc2)cc1)C(=O)NO |
| InChI | InChI=1S/C23H20F2N2O5/c1-23(32-2,22(24)25)19(21(30)27-31)26-20(29)17-11-7-15(8-12-17)5-3-4-6-16-9-13-18(28)14-10-16/h7-14,19,22,28,31H,1-2H3,(H,26,29)(H,27,30)/t19-,23?/m1/s1 |
| InChIKey | BPAALLKIVYZUJT-HWYAHNCWSA-N |
| XLogP | 2.07 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.42 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|