C16H15F2N3O3 — CID 87085407
N-[(2S)-3-amino-4,4-difluoro-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-buta-1,3-diynylbenzamide (PubChem CID 87085407) has the molecular formula C16H15F2N3O3 and a molecular weight of 335.31 g/mol. Its IUPAC name is N-[(2S)-3-amino-4,4-difluoro-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-buta-1,3-diynylbenzamide.
| Compound Name | N-[(2S)-3-amino-4,4-difluoro-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-buta-1,3-diynylbenzamide |
|---|---|
| PubChem CID | 87085407 |
| Molecular Formula | C16H15F2N3O3 |
| Molecular Weight | 335.31 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | N-[(2S)-3-amino-4,4-difluoro-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-buta-1,3-diynylbenzamide |
| SMILES | C#CC#Cc1ccc(C(=O)N[C@H](C(=O)NO)C(C)(N)C(F)F)cc1 |
| InChI | InChI=1S/C16H15F2N3O3/c1-3-4-5-10-6-8-11(9-7-10)13(22)20-12(14(23)21-24)16(2,19)15(17)18/h1,6-9,12,15,24H,19H2,2H3,(H,20,22)(H,21,23)/t12-,16?/m1/s1 |
| InChIKey | KYRYSXZBSZXOCE-ZGTOLYCTSA-N |
| XLogP | 0.26 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.31 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|