C25H21F2N3O6 — CID 87085086
4-[4-[4-[[(2S)-3-acetamido-4,4-difluoro-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]carbamoyl]phenyl]buta-1,3-diynyl]benzoic acid (PubChem CID 87085086) has the molecular formula C25H21F2N3O6 and a molecular weight of 497.45 g/mol. Its IUPAC name is 4-[4-[4-[[(2S)-3-acetamido-4,4-difluoro-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]carbamoyl]phenyl]buta-1,3-diynyl]benzoic acid.
| Compound Name | 4-[4-[4-[[(2S)-3-acetamido-4,4-difluoro-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]carbamoyl]phenyl]buta-1,3-diynyl]benzoic acid |
|---|---|
| PubChem CID | 87085086 |
| Molecular Formula | C25H21F2N3O6 |
| Molecular Weight | 497.45 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | 4-[4-[4-[[(2S)-3-acetamido-4,4-difluoro-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]carbamoyl]phenyl]buta-1,3-diynyl]benzoic acid |
| SMILES | CC(=O)NC(C)(C(F)F)[C@H](NC(=O)c1ccc(C#CC#Cc2ccc(C(=O)O)cc2)cc1)C(=O)NO |
| InChI | InChI=1S/C25H21F2N3O6/c1-15(31)29-25(2,24(26)27)20(22(33)30-36)28-21(32)18-11-7-16(8-12-18)5-3-4-6-17-9-13-19(14-10-17)23(34)35/h7-14,20,24,36H,1-2H3,(H,28,32)(H,29,31)(H,30,33)(H,34,35)/t20-,25?/m1/s1 |
| InChIKey | AEVCRSZOVGTNHL-VGOKPJQXSA-N |
| XLogP | 1.55 |
| TPSA | 144.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.45 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|