C23H23F2N3O5 — CID 130347607
N-[(2S)-3-acetamido-4,4-difluoro-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-[2-(4-methoxyphenyl)ethynyl]benzamide (PubChem CID 130347607) has the molecular formula C23H23F2N3O5 and a molecular weight of 459.45 g/mol. Its IUPAC name is N-[(2S)-3-acetamido-4,4-difluoro-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-[2-(4-methoxyphenyl)ethynyl]benzamide.
| Compound Name | N-[(2S)-3-acetamido-4,4-difluoro-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-[2-(4-methoxyphenyl)ethynyl]benzamide |
|---|---|
| PubChem CID | 130347607 |
| Molecular Formula | C23H23F2N3O5 |
| Molecular Weight | 459.45 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | N-[(2S)-3-acetamido-4,4-difluoro-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-[2-(4-methoxyphenyl)ethynyl]benzamide |
| SMILES | COc1ccc(C#Cc2ccc(C(=O)N[C@H](C(=O)NO)C(C)(NC(C)=O)C(F)F)cc2)cc1 |
| InChI | InChI=1S/C23H23F2N3O5/c1-14(29)27-23(2,22(24)25)19(21(31)28-32)26-20(30)17-10-6-15(7-11-17)4-5-16-8-12-18(33-3)13-9-16/h6-13,19,22,32H,1-3H3,(H,26,30)(H,27,29)(H,28,31)/t19-,23?/m1/s1 |
| InChIKey | KUCJGAQGZIRJGX-HWYAHNCWSA-N |
| XLogP | 1.86 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.45 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|