C24H22F2N4O4 — CID 87084903
N-[(2S)-3-acetamido-4,4-difluoro-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-[4-(2-aminophenyl)buta-1,3-diynyl]benzamide (PubChem CID 87084903) has the molecular formula C24H22F2N4O4 and a molecular weight of 468.46 g/mol. Its IUPAC name is N-[(2S)-3-acetamido-4,4-difluoro-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-[4-(2-aminophenyl)buta-1,3-diynyl]benzamide.
| Compound Name | N-[(2S)-3-acetamido-4,4-difluoro-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-[4-(2-aminophenyl)buta-1,3-diynyl]benzamide |
|---|---|
| PubChem CID | 87084903 |
| Molecular Formula | C24H22F2N4O4 |
| Molecular Weight | 468.46 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | N-[(2S)-3-acetamido-4,4-difluoro-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-[4-(2-aminophenyl)buta-1,3-diynyl]benzamide |
| SMILES | CC(=O)NC(C)(C(F)F)[C@H](NC(=O)c1ccc(C#CC#Cc2ccccc2N)cc1)C(=O)NO |
| InChI | InChI=1S/C24H22F2N4O4/c1-15(31)29-24(2,23(25)26)20(22(33)30-34)28-21(32)18-13-11-16(12-14-18)7-3-4-8-17-9-5-6-10-19(17)27/h5-6,9-14,20,23,34H,27H2,1-2H3,(H,28,32)(H,29,31)(H,30,33)/t20-,24?/m1/s1 |
| InChIKey | IKTATOFFGVULJS-CGHJUBPDSA-N |
| XLogP | 1.44 |
| TPSA | 133.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.46 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|