C24H26F2N6O5 — CID 130347591
N-[(2S)-4,4-difluoro-1-(hydroxyamino)-3-methyl-3-(methylcarbamoylamino)-1-oxobutan-2-yl]-4-[2-[4-(methylcarbamoylamino)phenyl]ethynyl]benzamide (PubChem CID 130347591) has the molecular formula C24H26F2N6O5 and a molecular weight of 516.51 g/mol. Its IUPAC name is N-[(2S)-4,4-difluoro-1-(hydroxyamino)-3-methyl-3-(methylcarbamoylamino)-1-oxobutan-2-yl]-4-[2-[4-(methylcarbamoylamino)phenyl]ethynyl]benzamide.
| Compound Name | N-[(2S)-4,4-difluoro-1-(hydroxyamino)-3-methyl-3-(methylcarbamoylamino)-1-oxobutan-2-yl]-4-[2-[4-(methylcarbamoylamino)phenyl]ethynyl]benzamide |
|---|---|
| PubChem CID | 130347591 |
| Molecular Formula | C24H26F2N6O5 |
| Molecular Weight | 516.51 g/mol |
| Exact Mass | 516.19 |
| IUPAC Name | N-[(2S)-4,4-difluoro-1-(hydroxyamino)-3-methyl-3-(methylcarbamoylamino)-1-oxobutan-2-yl]-4-[2-[4-(methylcarbamoylamino)phenyl]ethynyl]benzamide |
| SMILES | CNC(=O)Nc1ccc(C#Cc2ccc(C(=O)N[C@H](C(=O)NO)C(C)(NC(=O)NC)C(F)F)cc2)cc1 |
| InChI | InChI=1S/C24H26F2N6O5/c1-24(21(25)26,31-23(36)28-3)18(20(34)32-37)30-19(33)16-10-6-14(7-11-16)4-5-15-8-12-17(13-9-15)29-22(35)27-2/h6-13,18,21,37H,1-3H3,(H,30,33)(H,32,34)(H2,27,29,35)(H2,28,31,36)/t18-,24?/m1/s1 |
| InChIKey | IFWASJWZNPGYIX-QFADGXAASA-N |
| XLogP | 1.39 |
| TPSA | 160.69 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.51 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|