C22H23F2N5O4 — CID 130347679
4-[2-(2-aminophenyl)ethynyl]-N-[(2S)-4,4-difluoro-1-(hydroxyamino)-3-methyl-3-(methylcarbamoylamino)-1-oxobutan-2-yl]benzamide (PubChem CID 130347679) has the molecular formula C22H23F2N5O4 and a molecular weight of 459.45 g/mol. Its IUPAC name is 4-[2-(2-aminophenyl)ethynyl]-N-[(2S)-4,4-difluoro-1-(hydroxyamino)-3-methyl-3-(methylcarbamoylamino)-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-[2-(2-aminophenyl)ethynyl]-N-[(2S)-4,4-difluoro-1-(hydroxyamino)-3-methyl-3-(methylcarbamoylamino)-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 130347679 |
| Molecular Formula | C22H23F2N5O4 |
| Molecular Weight | 459.45 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | 4-[2-(2-aminophenyl)ethynyl]-N-[(2S)-4,4-difluoro-1-(hydroxyamino)-3-methyl-3-(methylcarbamoylamino)-1-oxobutan-2-yl]benzamide |
| SMILES | CNC(=O)NC(C)(C(F)F)[C@H](NC(=O)c1ccc(C#Cc2ccccc2N)cc1)C(=O)NO |
| InChI | InChI=1S/C22H23F2N5O4/c1-22(20(23)24,28-21(32)26-2)17(19(31)29-33)27-18(30)15-11-8-13(9-12-15)7-10-14-5-3-4-6-16(14)25/h3-6,8-9,11-12,17,20,33H,25H2,1-2H3,(H,27,30)(H,29,31)(H2,26,28,32)/t17-,22?/m1/s1 |
| InChIKey | IYVOCGMFJRKZOE-PLEWWHCXSA-N |
| XLogP | 1.23 |
| TPSA | 145.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.45 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|