C25H24F2N4O6S — CID 87085019
N-[(2S)-3-acetamido-4,4-difluoro-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-[4-[4-(methanesulfonamido)phenyl]buta-1,3-diynyl]benzamide (PubChem CID 87085019) has the molecular formula C25H24F2N4O6S and a molecular weight of 546.55 g/mol. Its IUPAC name is N-[(2S)-3-acetamido-4,4-difluoro-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-[4-[4-(methanesulfonamido)phenyl]buta-1,3-diynyl]benzamide.
| Compound Name | N-[(2S)-3-acetamido-4,4-difluoro-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-[4-[4-(methanesulfonamido)phenyl]buta-1,3-diynyl]benzamide |
|---|---|
| PubChem CID | 87085019 |
| Molecular Formula | C25H24F2N4O6S |
| Molecular Weight | 546.55 g/mol |
| Exact Mass | 546.14 |
| IUPAC Name | N-[(2S)-3-acetamido-4,4-difluoro-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-[4-[4-(methanesulfonamido)phenyl]buta-1,3-diynyl]benzamide |
| SMILES | CC(=O)NC(C)(C(F)F)[C@H](NC(=O)c1ccc(C#CC#Cc2ccc(NS(C)(=O)=O)cc2)cc1)C(=O)NO |
| InChI | InChI=1S/C25H24F2N4O6S/c1-16(32)29-25(2,24(26)27)21(23(34)30-35)28-22(33)19-12-8-17(9-13-19)6-4-5-7-18-10-14-20(15-11-18)31-38(3,36)37/h8-15,21,24,31,35H,1-3H3,(H,28,33)(H,29,32)(H,30,34)/t21-,25?/m1/s1 |
| InChIKey | GYWOYQDBFHITKE-JGKWMGOWSA-N |
| XLogP | 1.23 |
| TPSA | 153.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.55 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|