C25H23F2N3O5 — CID 87085029
4-[4-(4-acetamidophenyl)buta-1,3-diynyl]-N-[(2S)-4,4-difluoro-1-(hydroxyamino)-3-methoxy-3-methyl-1-oxobutan-2-yl]benzamide (PubChem CID 87085029) has the molecular formula C25H23F2N3O5 and a molecular weight of 483.47 g/mol. Its IUPAC name is 4-[4-(4-acetamidophenyl)buta-1,3-diynyl]-N-[(2S)-4,4-difluoro-1-(hydroxyamino)-3-methoxy-3-methyl-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-[4-(4-acetamidophenyl)buta-1,3-diynyl]-N-[(2S)-4,4-difluoro-1-(hydroxyamino)-3-methoxy-3-methyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 87085029 |
| Molecular Formula | C25H23F2N3O5 |
| Molecular Weight | 483.47 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | 4-[4-(4-acetamidophenyl)buta-1,3-diynyl]-N-[(2S)-4,4-difluoro-1-(hydroxyamino)-3-methoxy-3-methyl-1-oxobutan-2-yl]benzamide |
| SMILES | COC(C)(C(F)F)[C@H](NC(=O)c1ccc(C#CC#Cc2ccc(NC(C)=O)cc2)cc1)C(=O)NO |
| InChI | InChI=1S/C25H23F2N3O5/c1-16(31)28-20-14-10-18(11-15-20)7-5-4-6-17-8-12-19(13-9-17)22(32)29-21(23(33)30-34)25(2,35-3)24(26)27/h8-15,21,24,34H,1-3H3,(H,28,31)(H,29,32)(H,30,33)/t21-,25?/m1/s1 |
| InChIKey | WNMPJXFUNGFPSB-JGKWMGOWSA-N |
| XLogP | 2.32 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.47 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|