C22H23F2N3O4 — CID 130347615
4-[2-[4-(aminomethyl)phenyl]ethynyl]-N-[(2S)-4,4-difluoro-1-(hydroxyamino)-3-methoxy-3-methyl-1-oxobutan-2-yl]benzamide (PubChem CID 130347615) has the molecular formula C22H23F2N3O4 and a molecular weight of 431.44 g/mol. Its IUPAC name is 4-[2-[4-(aminomethyl)phenyl]ethynyl]-N-[(2S)-4,4-difluoro-1-(hydroxyamino)-3-methoxy-3-methyl-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-[2-[4-(aminomethyl)phenyl]ethynyl]-N-[(2S)-4,4-difluoro-1-(hydroxyamino)-3-methoxy-3-methyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 130347615 |
| Molecular Formula | C22H23F2N3O4 |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 4-[2-[4-(aminomethyl)phenyl]ethynyl]-N-[(2S)-4,4-difluoro-1-(hydroxyamino)-3-methoxy-3-methyl-1-oxobutan-2-yl]benzamide |
| SMILES | COC(C)(C(F)F)[C@H](NC(=O)c1ccc(C#Cc2ccc(CN)cc2)cc1)C(=O)NO |
| InChI | InChI=1S/C22H23F2N3O4/c1-22(31-2,21(23)24)18(20(29)27-30)26-19(28)17-11-9-15(10-12-17)4-3-14-5-7-16(13-25)8-6-14/h5-12,18,21,30H,13,25H2,1-2H3,(H,26,28)(H,27,29)/t18-,22?/m1/s1 |
| InChIKey | HKTNDDZDDSOPCT-ZZWBGTBQSA-N |
| XLogP | 1.82 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|