C28H30N4O4S2 — CID 157087094
N-[(2S,3R)-3-[4-(aminomethyl)phenyl]-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[4-(4-aminophenyl)buta-1,3-diynyl]benzamide;sulfane (PubChem CID 157087094) has the molecular formula C28H30N4O4S2 and a molecular weight of 550.71 g/mol. Its IUPAC name is N-[(2S,3R)-3-[4-(aminomethyl)phenyl]-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[4-(4-aminophenyl)buta-1,3-diynyl]benzamide;sulfane.
| Compound Name | N-[(2S,3R)-3-[4-(aminomethyl)phenyl]-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[4-(4-aminophenyl)buta-1,3-diynyl]benzamide;sulfane |
|---|---|
| PubChem CID | 157087094 |
| Molecular Formula | C28H30N4O4S2 |
| Molecular Weight | 550.71 g/mol |
| Exact Mass | 550.17 |
| IUPAC Name | N-[(2S,3R)-3-[4-(aminomethyl)phenyl]-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[4-(4-aminophenyl)buta-1,3-diynyl]benzamide;sulfane |
| SMILES | C[C@@](O)(c1ccc(CN)cc1)[C@H](NC(=O)c1ccc(C#CC#Cc2ccc(N)cc2)cc1)C(=O)NO.S.S |
| InChI | InChI=1S/C28H26N4O4.2H2S/c1-28(35,23-14-8-21(18-29)9-15-23)25(27(34)32-36)31-26(33)22-12-6-19(7-13-22)4-2-3-5-20-10-16-24(30)17-11-20;;/h6-17,25,35-36H,18,29-30H2,1H3,(H,31,33)(H,32,34);2*1H2/t25-,28-;;/m1../s1 |
| InChIKey | AEFGVXWYLUGYOY-OHYPFUGOSA-N |
| XLogP | 1.87 |
| TPSA | 150.70 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.71 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|