C27H27F2N3O5 — CID 87084906
N-[(2S)-4,4-difluoro-3-hydroxy-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-[4-[4-(morpholin-4-ylmethyl)phenyl]buta-1,3-diynyl]benzamide (PubChem CID 87084906) has the molecular formula C27H27F2N3O5 and a molecular weight of 511.53 g/mol. Its IUPAC name is N-[(2S)-4,4-difluoro-3-hydroxy-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-[4-[4-(morpholin-4-ylmethyl)phenyl]buta-1,3-diynyl]benzamide.
| Compound Name | N-[(2S)-4,4-difluoro-3-hydroxy-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-[4-[4-(morpholin-4-ylmethyl)phenyl]buta-1,3-diynyl]benzamide |
|---|---|
| PubChem CID | 87084906 |
| Molecular Formula | C27H27F2N3O5 |
| Molecular Weight | 511.53 g/mol |
| Exact Mass | 511.19 |
| IUPAC Name | N-[(2S)-4,4-difluoro-3-hydroxy-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-[4-[4-(morpholin-4-ylmethyl)phenyl]buta-1,3-diynyl]benzamide |
| SMILES | CC(O)(C(F)F)[C@H](NC(=O)c1ccc(C#CC#Cc2ccc(CN3CCOCC3)cc2)cc1)C(=O)NO |
| InChI | InChI=1S/C27H27F2N3O5/c1-27(35,26(28)29)23(25(34)31-36)30-24(33)22-12-10-20(11-13-22)5-3-2-4-19-6-8-21(9-7-19)18-32-14-16-37-17-15-32/h6-13,23,26,35-36H,14-18H2,1H3,(H,30,33)(H,31,34)/t23-,27?/m1/s1 |
| InChIKey | MPARKLREYXRODM-BRIWLPCBSA-N |
| XLogP | 1.54 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.53 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|