C19H23F2N3O5 — CID 171510026
N-[(3S)-4,4-difluoro-3-hydroxy-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-(3-morpholin-4-ylprop-1-ynyl)benzamide (PubChem CID 171510026) has the molecular formula C19H23F2N3O5 and a molecular weight of 411.41 g/mol. Its IUPAC name is N-[(3S)-4,4-difluoro-3-hydroxy-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-(3-morpholin-4-ylprop-1-ynyl)benzamide.
| Compound Name | N-[(3S)-4,4-difluoro-3-hydroxy-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-(3-morpholin-4-ylprop-1-ynyl)benzamide |
|---|---|
| PubChem CID | 171510026 |
| Molecular Formula | C19H23F2N3O5 |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | N-[(3S)-4,4-difluoro-3-hydroxy-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-(3-morpholin-4-ylprop-1-ynyl)benzamide |
| SMILES | C[C@@](O)(C(F)F)C(NC(=O)c1ccc(C#CCN2CCOCC2)cc1)C(=O)NO |
| InChI | InChI=1S/C19H23F2N3O5/c1-19(27,18(20)21)15(17(26)23-28)22-16(25)14-6-4-13(5-7-14)3-2-8-24-9-11-29-12-10-24/h4-7,15,18,27-28H,8-12H2,1H3,(H,22,25)(H,23,26)/t15?,19-/m0/s1 |
| InChIKey | CFZCXCRQEGGSNW-FUBQLUNQSA-N |
| XLogP | -0.01 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|