C19H23F2N3O4 — CID 171509950
N-[(2S,3S)-4,4-difluoro-3-hydroxy-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-[2-(1-methylaziridin-2-yl)ethynyl]benzamide;ethene (PubChem CID 171509950) has the molecular formula C19H23F2N3O4 and a molecular weight of 395.41 g/mol. Its IUPAC name is N-[(2S,3S)-4,4-difluoro-3-hydroxy-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-[2-(1-methylaziridin-2-yl)ethynyl]benzamide;ethene.
| Compound Name | N-[(2S,3S)-4,4-difluoro-3-hydroxy-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-[2-(1-methylaziridin-2-yl)ethynyl]benzamide;ethene |
|---|---|
| PubChem CID | 171509950 |
| Molecular Formula | C19H23F2N3O4 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | N-[(2S,3S)-4,4-difluoro-3-hydroxy-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-[2-(1-methylaziridin-2-yl)ethynyl]benzamide;ethene |
| SMILES | C=C.CN1CC1C#Cc1ccc(C(=O)N[C@H](C(=O)NO)[C@](C)(O)C(F)F)cc1 |
| InChI | InChI=1S/C17H19F2N3O4.C2H4/c1-17(25,16(18)19)13(15(24)21-26)20-14(23)11-6-3-10(4-7-11)5-8-12-9-22(12)2;1-2/h3-4,6-7,12-13,16,25-26H,9H2,1-2H3,(H,20,23)(H,21,24);1-2H2/t12?,13-,17+,22?;/m1./s1 |
| InChIKey | ZUMJWYZATUMFBD-HUYNBEEHSA-N |
| XLogP | 0.77 |
| TPSA | 101.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|