C22H26FN3O4 — CID 86298350
4-[6-(3-fluoropyrrolidin-1-yl)hexa-1,3-diynyl]-N-[(2S)-3-hydroxy-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]benzamide (PubChem CID 86298350) has the molecular formula C22H26FN3O4 and a molecular weight of 415.47 g/mol. Its IUPAC name is 4-[6-(3-fluoropyrrolidin-1-yl)hexa-1,3-diynyl]-N-[(2S)-3-hydroxy-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-[6-(3-fluoropyrrolidin-1-yl)hexa-1,3-diynyl]-N-[(2S)-3-hydroxy-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 86298350 |
| Molecular Formula | C22H26FN3O4 |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | 4-[6-(3-fluoropyrrolidin-1-yl)hexa-1,3-diynyl]-N-[(2S)-3-hydroxy-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]benzamide |
| SMILES | CC(C)(O)[C@H](NC(=O)c1ccc(C#CC#CCCN2CCC(F)C2)cc1)C(=O)NO |
| InChI | InChI=1S/C22H26FN3O4/c1-22(2,29)19(21(28)25-30)24-20(27)17-10-8-16(9-11-17)7-5-3-4-6-13-26-14-12-18(23)15-26/h8-11,18-19,29-30H,6,12-15H2,1-2H3,(H,24,27)(H,25,28)/t18?,19-/m1/s1 |
| InChIKey | ZSNVCHKXSJRFIJ-MUMRKEEXSA-N |
| XLogP | 0.85 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|