C19H21F2N3O3 — CID 123176699
N-[3-amino-4,4-difluoro-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-(3-methylhexa-3,5-dien-1-ynyl)benzamide (PubChem CID 123176699) has the molecular formula C19H21F2N3O3 and a molecular weight of 377.39 g/mol. Its IUPAC name is N-[3-amino-4,4-difluoro-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-(3-methylhexa-3,5-dien-1-ynyl)benzamide.
| Compound Name | N-[3-amino-4,4-difluoro-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-(3-methylhexa-3,5-dien-1-ynyl)benzamide |
|---|---|
| PubChem CID | 123176699 |
| Molecular Formula | C19H21F2N3O3 |
| Molecular Weight | 377.39 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | N-[3-amino-4,4-difluoro-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-(3-methylhexa-3,5-dien-1-ynyl)benzamide |
| SMILES | C=CC=C(C)C#Cc1ccc(C(=O)NC(C(=O)NO)C(C)(N)C(F)F)cc1 |
| InChI | InChI=1S/C19H21F2N3O3/c1-4-5-12(2)6-7-13-8-10-14(11-9-13)16(25)23-15(17(26)24-27)19(3,22)18(20)21/h4-5,8-11,15,18,27H,1,22H2,2-3H3,(H,23,25)(H,24,26) |
| InChIKey | CIBMVKLUADCZSL-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.39 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|