C22H22F2N2O5 — CID 130347713
N-[(2S)-4,4-difluoro-1-(hydroxyamino)-3-methoxy-3-methyl-1-oxobutan-2-yl]-4-[2-(4-methoxyphenyl)ethynyl]benzamide (PubChem CID 130347713) has the molecular formula C22H22F2N2O5 and a molecular weight of 432.42 g/mol. Its IUPAC name is N-[(2S)-4,4-difluoro-1-(hydroxyamino)-3-methoxy-3-methyl-1-oxobutan-2-yl]-4-[2-(4-methoxyphenyl)ethynyl]benzamide.
| Compound Name | N-[(2S)-4,4-difluoro-1-(hydroxyamino)-3-methoxy-3-methyl-1-oxobutan-2-yl]-4-[2-(4-methoxyphenyl)ethynyl]benzamide |
|---|---|
| PubChem CID | 130347713 |
| Molecular Formula | C22H22F2N2O5 |
| Molecular Weight | 432.42 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | N-[(2S)-4,4-difluoro-1-(hydroxyamino)-3-methoxy-3-methyl-1-oxobutan-2-yl]-4-[2-(4-methoxyphenyl)ethynyl]benzamide |
| SMILES | COc1ccc(C#Cc2ccc(C(=O)N[C@H](C(=O)NO)C(C)(OC)C(F)F)cc2)cc1 |
| InChI | InChI=1S/C22H22F2N2O5/c1-22(31-3,21(23)24)18(20(28)26-29)25-19(27)16-10-6-14(7-11-16)4-5-15-8-12-17(30-2)13-9-15/h6-13,18,21,29H,1-3H3,(H,25,27)(H,26,28)/t18-,22?/m1/s1 |
| InChIKey | LTVAFJIAAYLMMN-ZZWBGTBQSA-N |
| XLogP | 2.37 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.42 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|