C23H24F2N4O5 — CID 130347759
N-[(2S)-4,4-difluoro-1-(hydroxyamino)-3-methoxy-3-methyl-1-oxobutan-2-yl]-4-[2-[4-(methylcarbamoylamino)phenyl]ethynyl]benzamide (PubChem CID 130347759) has the molecular formula C23H24F2N4O5 and a molecular weight of 474.46 g/mol. Its IUPAC name is N-[(2S)-4,4-difluoro-1-(hydroxyamino)-3-methoxy-3-methyl-1-oxobutan-2-yl]-4-[2-[4-(methylcarbamoylamino)phenyl]ethynyl]benzamide.
| Compound Name | N-[(2S)-4,4-difluoro-1-(hydroxyamino)-3-methoxy-3-methyl-1-oxobutan-2-yl]-4-[2-[4-(methylcarbamoylamino)phenyl]ethynyl]benzamide |
|---|---|
| PubChem CID | 130347759 |
| Molecular Formula | C23H24F2N4O5 |
| Molecular Weight | 474.46 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | N-[(2S)-4,4-difluoro-1-(hydroxyamino)-3-methoxy-3-methyl-1-oxobutan-2-yl]-4-[2-[4-(methylcarbamoylamino)phenyl]ethynyl]benzamide |
| SMILES | CNC(=O)Nc1ccc(C#Cc2ccc(C(=O)N[C@H](C(=O)NO)C(C)(OC)C(F)F)cc2)cc1 |
| InChI | InChI=1S/C23H24F2N4O5/c1-23(34-3,21(24)25)18(20(31)29-33)28-19(30)16-10-6-14(7-11-16)4-5-15-8-12-17(13-9-15)27-22(32)26-2/h6-13,18,21,33H,1-3H3,(H,28,30)(H,29,31)(H2,26,27,32)/t18-,23?/m1/s1 |
| InChIKey | COWJKKBTOPNHDW-FKSKYRLFSA-N |
| XLogP | 2.11 |
| TPSA | 128.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.46 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|