C24H21ClF2N4O4 — CID 56928997
4-[4-(4-chlorophenyl)buta-1,3-diynyl]-N-[4,4-difluoro-1-(hydroxyamino)-3-methyl-3-(methylcarbamoylamino)-1-oxobutan-2-yl]benzamide (PubChem CID 56928997) has the molecular formula C24H21ClF2N4O4 and a molecular weight of 502.91 g/mol. Its IUPAC name is 4-[4-(4-chlorophenyl)buta-1,3-diynyl]-N-[4,4-difluoro-1-(hydroxyamino)-3-methyl-3-(methylcarbamoylamino)-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-[4-(4-chlorophenyl)buta-1,3-diynyl]-N-[4,4-difluoro-1-(hydroxyamino)-3-methyl-3-(methylcarbamoylamino)-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 56928997 |
| Molecular Formula | C24H21ClF2N4O4 |
| Molecular Weight | 502.91 g/mol |
| Exact Mass | 502.12 |
| IUPAC Name | 4-[4-(4-chlorophenyl)buta-1,3-diynyl]-N-[4,4-difluoro-1-(hydroxyamino)-3-methyl-3-(methylcarbamoylamino)-1-oxobutan-2-yl]benzamide |
| SMILES | CNC(=O)NC(C)(C(F)F)C(NC(=O)c1ccc(C#CC#Cc2ccc(Cl)cc2)cc1)C(=O)NO |
| InChI | InChI=1S/C24H21ClF2N4O4/c1-24(22(26)27,30-23(34)28-2)19(21(33)31-35)29-20(32)17-11-7-15(8-12-17)5-3-4-6-16-9-13-18(25)14-10-16/h7-14,19,22,35H,1-2H3,(H,29,32)(H,31,33)(H2,28,30,34) |
| InChIKey | MROCNLAJJYRMOS-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 119.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.91 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|