C24H21F2N3O5 — CID 88583989
N-[(2S)-3-acetamido-4,4-difluoro-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-[4-(2-hydroxyphenyl)buta-1,3-diynyl]benzamide (PubChem CID 88583989) has the molecular formula C24H21F2N3O5 and a molecular weight of 469.44 g/mol. Its IUPAC name is N-[(2S)-3-acetamido-4,4-difluoro-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-[4-(2-hydroxyphenyl)buta-1,3-diynyl]benzamide.
| Compound Name | N-[(2S)-3-acetamido-4,4-difluoro-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-[4-(2-hydroxyphenyl)buta-1,3-diynyl]benzamide |
|---|---|
| PubChem CID | 88583989 |
| Molecular Formula | C24H21F2N3O5 |
| Molecular Weight | 469.44 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | N-[(2S)-3-acetamido-4,4-difluoro-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-[4-(2-hydroxyphenyl)buta-1,3-diynyl]benzamide |
| SMILES | CC(=O)NC(C)(C(F)F)[C@H](NC(=O)c1ccc(C#CC#Cc2ccccc2O)cc1)C(=O)NO |
| InChI | InChI=1S/C24H21F2N3O5/c1-15(30)28-24(2,23(25)26)20(22(33)29-34)27-21(32)18-13-11-16(12-14-18)7-3-4-8-17-9-5-6-10-19(17)31/h5-6,9-14,20,23,31,34H,1-2H3,(H,27,32)(H,28,30)(H,29,33)/t20-,24?/m1/s1 |
| InChIKey | ZLNJORWYAWKKFO-CGHJUBPDSA-N |
| XLogP | 1.56 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.44 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|