C25H30N4O5S — CID 59417412
N-[(2S)-3-amino-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-[2-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]ethynyl]benzamide (PubChem CID 59417412) has the molecular formula C25H30N4O5S and a molecular weight of 498.61 g/mol. Its IUPAC name is N-[(2S)-3-amino-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-[2-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]ethynyl]benzamide.
| Compound Name | N-[(2S)-3-amino-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-[2-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]ethynyl]benzamide |
|---|---|
| PubChem CID | 59417412 |
| Molecular Formula | C25H30N4O5S |
| Molecular Weight | 498.61 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | N-[(2S)-3-amino-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-[2-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]ethynyl]benzamide |
| SMILES | CC(C)(N)[C@H](NC(=O)c1ccc(C#Cc2ccc(CN3CCS(=O)(=O)CC3)cc2)cc1)C(=O)NO |
| InChI | InChI=1S/C25H30N4O5S/c1-25(2,26)22(24(31)28-32)27-23(30)21-11-9-19(10-12-21)4-3-18-5-7-20(8-6-18)17-29-13-15-35(33,34)16-14-29/h5-12,22,32H,13-17,26H2,1-2H3,(H,27,30)(H,28,31)/t22-/m1/s1 |
| InChIKey | HREXEXBGVFGJPX-JOCHJYFZSA-N |
| XLogP | 0.66 |
| TPSA | 141.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.61 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|