C22H25NO2S — CID 144791696
N-hydroxy-2-methyl-2-methylsulfanyl-6-[4-(2-phenylethynyl)phenyl]hexanamide (PubChem CID 144791696) has the molecular formula C22H25NO2S and a molecular weight of 367.51 g/mol. Its IUPAC name is N-hydroxy-2-methyl-2-methylsulfanyl-6-[4-(2-phenylethynyl)phenyl]hexanamide.
| Compound Name | N-hydroxy-2-methyl-2-methylsulfanyl-6-[4-(2-phenylethynyl)phenyl]hexanamide |
|---|---|
| PubChem CID | 144791696 |
| Molecular Formula | C22H25NO2S |
| Molecular Weight | 367.51 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | N-hydroxy-2-methyl-2-methylsulfanyl-6-[4-(2-phenylethynyl)phenyl]hexanamide |
| SMILES | CSC(C)(CCCCc1ccc(C#Cc2ccccc2)cc1)C(=O)NO |
| InChI | InChI=1S/C22H25NO2S/c1-22(26-2,21(24)23-25)17-7-6-10-19-12-15-20(16-13-19)14-11-18-8-4-3-5-9-18/h3-5,8-9,12-13,15-16,25H,6-7,10,17H2,1-2H3,(H,23,24) |
| InChIKey | OUWWBKVZTPWAFH-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.51 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|