C23H27NO2S — CID 144791706
N-hydroxy-2-methyl-2-methylsulfanyl-7-[4-(2-phenylethynyl)phenyl]heptanamide (PubChem CID 144791706) has the molecular formula C23H27NO2S and a molecular weight of 381.54 g/mol. Its IUPAC name is N-hydroxy-2-methyl-2-methylsulfanyl-7-[4-(2-phenylethynyl)phenyl]heptanamide.
| Compound Name | N-hydroxy-2-methyl-2-methylsulfanyl-7-[4-(2-phenylethynyl)phenyl]heptanamide |
|---|---|
| PubChem CID | 144791706 |
| Molecular Formula | C23H27NO2S |
| Molecular Weight | 381.54 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | N-hydroxy-2-methyl-2-methylsulfanyl-7-[4-(2-phenylethynyl)phenyl]heptanamide |
| SMILES | CSC(C)(CCCCCc1ccc(C#Cc2ccccc2)cc1)C(=O)NO |
| InChI | InChI=1S/C23H27NO2S/c1-23(27-2,22(25)24-26)18-8-4-7-11-20-13-16-21(17-14-20)15-12-19-9-5-3-6-10-19/h3,5-6,9-10,13-14,16-17,26H,4,7-8,11,18H2,1-2H3,(H,24,25) |
| InChIKey | BOGHMSPUHFTZLD-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.54 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|