C22H24O3S — CID 122450310
3-methyl-3-methylsulfonyl-6-[4-(2-phenylethynyl)phenyl]hexan-2-one (PubChem CID 122450310) has the molecular formula C22H24O3S and a molecular weight of 368.50 g/mol. Its IUPAC name is 3-methyl-3-methylsulfonyl-6-[4-(2-phenylethynyl)phenyl]hexan-2-one.
| Compound Name | 3-methyl-3-methylsulfonyl-6-[4-(2-phenylethynyl)phenyl]hexan-2-one |
|---|---|
| PubChem CID | 122450310 |
| Molecular Formula | C22H24O3S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 3-methyl-3-methylsulfonyl-6-[4-(2-phenylethynyl)phenyl]hexan-2-one |
| SMILES | CC(=O)C(C)(CCCc1ccc(C#Cc2ccccc2)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C22H24O3S/c1-18(23)22(2,26(3,24)25)17-7-10-20-12-15-21(16-13-20)14-11-19-8-5-4-6-9-19/h4-6,8-9,12-13,15-16H,7,10,17H2,1-3H3 |
| InChIKey | UQQSEZLFRCBRKE-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|