C19H24O5S — CID 130207835
methyl 4-[4-[2-[(1S)-2-(hydroxymethyl)cyclopropyl]ethynyl]phenyl]-2-methyl-2-methylsulfonylbutanoate (PubChem CID 130207835) has the molecular formula C19H24O5S and a molecular weight of 364.46 g/mol. Its IUPAC name is methyl 4-[4-[2-[(1S)-2-(hydroxymethyl)cyclopropyl]ethynyl]phenyl]-2-methyl-2-methylsulfonylbutanoate.
| Compound Name | methyl 4-[4-[2-[(1S)-2-(hydroxymethyl)cyclopropyl]ethynyl]phenyl]-2-methyl-2-methylsulfonylbutanoate |
|---|---|
| PubChem CID | 130207835 |
| Molecular Formula | C19H24O5S |
| Molecular Weight | 364.46 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | methyl 4-[4-[2-[(1S)-2-(hydroxymethyl)cyclopropyl]ethynyl]phenyl]-2-methyl-2-methylsulfonylbutanoate |
| SMILES | COC(=O)C(C)(CCc1ccc(C#C[C@H]2CC2CO)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C19H24O5S/c1-19(18(21)24-2,25(3,22)23)11-10-15-6-4-14(5-7-15)8-9-16-12-17(16)13-20/h4-7,16-17,20H,10-13H2,1-3H3/t16-,17?,19?/m0/s1 |
| InChIKey | FLYMLUQNPZSRBS-MUYFXNHWSA-N |
| XLogP | 1.58 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.46 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|