C15H18O4S — CID 118659596
methyl 4-(4-ethynylphenyl)-2-methyl-2-methylsulfonylbutanoate (PubChem CID 118659596) has the molecular formula C15H18O4S and a molecular weight of 294.37 g/mol. Its IUPAC name is methyl 4-(4-ethynylphenyl)-2-methyl-2-methylsulfonylbutanoate.
| Compound Name | methyl 4-(4-ethynylphenyl)-2-methyl-2-methylsulfonylbutanoate |
|---|---|
| PubChem CID | 118659596 |
| Molecular Formula | C15H18O4S |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | methyl 4-(4-ethynylphenyl)-2-methyl-2-methylsulfonylbutanoate |
| SMILES | C#Cc1ccc(CCC(C)(C(=O)OC)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C15H18O4S/c1-5-12-6-8-13(9-7-12)10-11-15(2,14(16)19-3)20(4,17)18/h1,6-9H,10-11H2,2-4H3 |
| InChIKey | IEZPSIRCOLSUBT-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|