C13H18BrNO4S — CID 86668759
ethyl 4-(6-bromo-3-pyridinyl)-2-methyl-2-methylsulfonylbutanoate (PubChem CID 86668759) has the molecular formula C13H18BrNO4S and a molecular weight of 364.26 g/mol. Its IUPAC name is ethyl 4-(6-bromo-3-pyridinyl)-2-methyl-2-methylsulfonylbutanoate.
| Compound Name | ethyl 4-(6-bromo-3-pyridinyl)-2-methyl-2-methylsulfonylbutanoate |
|---|---|
| PubChem CID | 86668759 |
| Molecular Formula | C13H18BrNO4S |
| Molecular Weight | 364.26 g/mol |
| Exact Mass | 363.01 |
| IUPAC Name | ethyl 4-(6-bromo-3-pyridinyl)-2-methyl-2-methylsulfonylbutanoate |
| SMILES | CCOC(=O)C(C)(CCc1ccc(Br)nc1)S(C)(=O)=O |
| InChI | InChI=1S/C13H18BrNO4S/c1-4-19-12(16)13(2,20(3,17)18)8-7-10-5-6-11(14)15-9-10/h5-6,9H,4,7-8H2,1-3H3 |
| InChIKey | DPVZXJLLMYHDCH-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.26 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|