C14H18BrFO4S — CID 66577925
ethyl 4-(4-bromo-2-fluorophenyl)-2-methyl-2-methylsulfonylbutanoate (PubChem CID 66577925) has the molecular formula C14H18BrFO4S and a molecular weight of 381.26 g/mol. Its IUPAC name is ethyl 4-(4-bromo-2-fluorophenyl)-2-methyl-2-methylsulfonylbutanoate.
| Compound Name | ethyl 4-(4-bromo-2-fluorophenyl)-2-methyl-2-methylsulfonylbutanoate |
|---|---|
| PubChem CID | 66577925 |
| Molecular Formula | C14H18BrFO4S |
| Molecular Weight | 381.26 g/mol |
| Exact Mass | 380.01 |
| IUPAC Name | ethyl 4-(4-bromo-2-fluorophenyl)-2-methyl-2-methylsulfonylbutanoate |
| SMILES | CCOC(=O)C(C)(CCc1ccc(Br)cc1F)S(C)(=O)=O |
| InChI | InChI=1S/C14H18BrFO4S/c1-4-20-13(17)14(2,21(3,18)19)8-7-10-5-6-11(15)9-12(10)16/h5-6,9H,4,7-8H2,1-3H3 |
| InChIKey | BQQLAKUHEYBNGD-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.26 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |