C20H27BrClNO6 — CID 46202880
diethyl 2-[2-(4-bromo-2-chlorophenyl)ethyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanedioate (PubChem CID 46202880) has the molecular formula C20H27BrClNO6 and a molecular weight of 492.79 g/mol. Its IUPAC name is diethyl 2-[2-(4-bromo-2-chlorophenyl)ethyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanedioate.
| Compound Name | diethyl 2-[2-(4-bromo-2-chlorophenyl)ethyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanedioate |
|---|---|
| PubChem CID | 46202880 |
| Molecular Formula | C20H27BrClNO6 |
| Molecular Weight | 492.79 g/mol |
| Exact Mass | 491.07 |
| IUPAC Name | diethyl 2-[2-(4-bromo-2-chlorophenyl)ethyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanedioate |
| SMILES | CCOC(=O)C(CCc1ccc(Br)cc1Cl)(NC(=O)OC(C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C20H27BrClNO6/c1-6-27-16(24)20(17(25)28-7-2,23-18(26)29-19(3,4)5)11-10-13-8-9-14(21)12-15(13)22/h8-9,12H,6-7,10-11H2,1-5H3,(H,23,26) |
| InChIKey | DQOTTXGAMXICQT-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.79 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|