C27H33Cl2NO7 — CID 23078162
diethyl 2-[3-[4-(3,5-dichlorophenoxy)phenyl]propyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanedioate (PubChem CID 23078162) has the molecular formula C27H33Cl2NO7 and a molecular weight of 554.47 g/mol. Its IUPAC name is diethyl 2-[3-[4-(3,5-dichlorophenoxy)phenyl]propyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanedioate.
| Compound Name | diethyl 2-[3-[4-(3,5-dichlorophenoxy)phenyl]propyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanedioate |
|---|---|
| PubChem CID | 23078162 |
| Molecular Formula | C27H33Cl2NO7 |
| Molecular Weight | 554.47 g/mol |
| Exact Mass | 553.16 |
| IUPAC Name | diethyl 2-[3-[4-(3,5-dichlorophenoxy)phenyl]propyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanedioate |
| SMILES | CCOC(=O)C(CCCc1ccc(Oc2cc(Cl)cc(Cl)c2)cc1)(NC(=O)OC(C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C27H33Cl2NO7/c1-6-34-23(31)27(24(32)35-7-2,30-25(33)37-26(3,4)5)14-8-9-18-10-12-21(13-11-18)36-22-16-19(28)15-20(29)17-22/h10-13,15-17H,6-9,14H2,1-5H3,(H,30,33) |
| InChIKey | GPYKZCJUWGZIPQ-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.47 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|