C33H40N2O9 — CID 58219466
diethyl 2-[2-[4-[5-(1,3-dioxoisoindol-2-yl)pentyl]phenyl]-2-oxoethyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanedioate (PubChem CID 58219466) has the molecular formula C33H40N2O9 and a molecular weight of 608.69 g/mol. Its IUPAC name is diethyl 2-[2-[4-[5-(1,3-dioxoisoindol-2-yl)pentyl]phenyl]-2-oxoethyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanedioate.
| Compound Name | diethyl 2-[2-[4-[5-(1,3-dioxoisoindol-2-yl)pentyl]phenyl]-2-oxoethyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanedioate |
|---|---|
| PubChem CID | 58219466 |
| Molecular Formula | C33H40N2O9 |
| Molecular Weight | 608.69 g/mol |
| Exact Mass | 608.27 |
| IUPAC Name | diethyl 2-[2-[4-[5-(1,3-dioxoisoindol-2-yl)pentyl]phenyl]-2-oxoethyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanedioate |
| SMILES | CCOC(=O)C(CC(=O)c1ccc(CCCCCN2C(=O)c3ccccc3C2=O)cc1)(NC(=O)OC(C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C33H40N2O9/c1-6-42-29(39)33(30(40)43-7-2,34-31(41)44-32(3,4)5)21-26(36)23-18-16-22(17-19-23)13-9-8-12-20-35-27(37)24-14-10-11-15-25(24)28(35)38/h10-11,14-19H,6-9,12-13,20-21H2,1-5H3,(H,34,41) |
| InChIKey | ZLTBSIIKORXXCT-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 145.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.69 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|