C27H36N2O9S2 — CID 102394914
diethyl 2-[4-(1,3-dioxoisoindol-2-yl)-2-ethoxycarbothioylsulfanylbutyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanedioate (PubChem CID 102394914) has the molecular formula C27H36N2O9S2 and a molecular weight of 596.72 g/mol. Its IUPAC name is diethyl 2-[4-(1,3-dioxoisoindol-2-yl)-2-ethoxycarbothioylsulfanylbutyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanedioate.
| Compound Name | diethyl 2-[4-(1,3-dioxoisoindol-2-yl)-2-ethoxycarbothioylsulfanylbutyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanedioate |
|---|---|
| PubChem CID | 102394914 |
| Molecular Formula | C27H36N2O9S2 |
| Molecular Weight | 596.72 g/mol |
| Exact Mass | 596.19 |
| IUPAC Name | diethyl 2-[4-(1,3-dioxoisoindol-2-yl)-2-ethoxycarbothioylsulfanylbutyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanedioate |
| SMILES | CCOC(=O)C(CC(CCN1C(=O)c2ccccc2C1=O)SC(=S)OCC)(NC(=O)OC(C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C27H36N2O9S2/c1-7-35-22(32)27(23(33)36-8-2,28-24(34)38-26(4,5)6)16-17(40-25(39)37-9-3)14-15-29-20(30)18-12-10-11-13-19(18)21(29)31/h10-13,17H,7-9,14-16H2,1-6H3,(H,28,34) |
| InChIKey | OSRMYZBYXMGALH-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 137.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.72 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|