C23H29F2NO7S2 — CID 11813470
diethyl 2-acetamido-2-[5-(2,4-difluorophenyl)-2-ethoxycarbothioylsulfanyl-5-oxopentyl]propanedioate (PubChem CID 11813470) has the molecular formula C23H29F2NO7S2 and a molecular weight of 533.62 g/mol. Its IUPAC name is diethyl 2-acetamido-2-[5-(2,4-difluorophenyl)-2-ethoxycarbothioylsulfanyl-5-oxopentyl]propanedioate.
| Compound Name | diethyl 2-acetamido-2-[5-(2,4-difluorophenyl)-2-ethoxycarbothioylsulfanyl-5-oxopentyl]propanedioate |
|---|---|
| PubChem CID | 11813470 |
| Molecular Formula | C23H29F2NO7S2 |
| Molecular Weight | 533.62 g/mol |
| Exact Mass | 533.14 |
| IUPAC Name | diethyl 2-acetamido-2-[5-(2,4-difluorophenyl)-2-ethoxycarbothioylsulfanyl-5-oxopentyl]propanedioate |
| SMILES | CCOC(=O)C(CC(CCC(=O)c1ccc(F)cc1F)SC(=S)OCC)(NC(C)=O)C(=O)OCC |
| InChI | InChI=1S/C23H29F2NO7S2/c1-5-31-20(29)23(26-14(4)27,21(30)32-6-2)13-16(35-22(34)33-7-3)9-11-19(28)17-10-8-15(24)12-18(17)25/h8,10,12,16H,5-7,9,11,13H2,1-4H3,(H,26,27) |
| InChIKey | BDKIZJYXBXSLAD-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.62 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|