C24H30N2O8S2 — CID 11533938
diethyl 2-acetamido-2-(4-benzoyloxy-4-cyano-2-ethoxycarbothioylsulfanylbutyl)propanedioate (PubChem CID 11533938) has the molecular formula C24H30N2O8S2 and a molecular weight of 538.64 g/mol. Its IUPAC name is diethyl 2-acetamido-2-(4-benzoyloxy-4-cyano-2-ethoxycarbothioylsulfanylbutyl)propanedioate.
| Compound Name | diethyl 2-acetamido-2-(4-benzoyloxy-4-cyano-2-ethoxycarbothioylsulfanylbutyl)propanedioate |
|---|---|
| PubChem CID | 11533938 |
| Molecular Formula | C24H30N2O8S2 |
| Molecular Weight | 538.64 g/mol |
| Exact Mass | 538.14 |
| IUPAC Name | diethyl 2-acetamido-2-(4-benzoyloxy-4-cyano-2-ethoxycarbothioylsulfanylbutyl)propanedioate |
| SMILES | CCOC(=O)C(CC(CC(C#N)OC(=O)c1ccccc1)SC(=S)OCC)(NC(C)=O)C(=O)OCC |
| InChI | InChI=1S/C24H30N2O8S2/c1-5-31-21(29)24(26-16(4)27,22(30)32-6-2)14-19(36-23(35)33-7-3)13-18(15-25)34-20(28)17-11-9-8-10-12-17/h8-12,18-19H,5-7,13-14H2,1-4H3,(H,26,27) |
| InChIKey | ROLNQGNJDDUJNC-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 141.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.64 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|