C12H12F3NO2S2 — CID 141224381
O-ethyl (1-benzamido-2,2,2-trifluoroethyl)sulfanylmethanethioate (PubChem CID 141224381) has the molecular formula C12H12F3NO2S2 and a molecular weight of 323.36 g/mol. Its IUPAC name is O-ethyl (1-benzamido-2,2,2-trifluoroethyl)sulfanylmethanethioate.
| Compound Name | O-ethyl (1-benzamido-2,2,2-trifluoroethyl)sulfanylmethanethioate |
|---|---|
| PubChem CID | 141224381 |
| Molecular Formula | C12H12F3NO2S2 |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | O-ethyl (1-benzamido-2,2,2-trifluoroethyl)sulfanylmethanethioate |
| SMILES | CCOC(=S)SC(NC(=O)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C12H12F3NO2S2/c1-2-18-11(19)20-10(12(13,14)15)16-9(17)8-6-4-3-5-7-8/h3-7,10H,2H2,1H3,(H,16,17) |
| InChIKey | FGXATXKXQGDKGS-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|