C28H30N2O8 — CID 138392491
diethyl 3,4-diacetyl-2,5-dibenzamidohex-3-enedioate (PubChem CID 138392491) has the molecular formula C28H30N2O8 and a molecular weight of 522.55 g/mol. Its IUPAC name is diethyl 3,4-diacetyl-2,5-dibenzamidohex-3-enedioate.
| Compound Name | diethyl 3,4-diacetyl-2,5-dibenzamidohex-3-enedioate |
|---|---|
| PubChem CID | 138392491 |
| Molecular Formula | C28H30N2O8 |
| Molecular Weight | 522.55 g/mol |
| Exact Mass | 522.20 |
| IUPAC Name | diethyl 3,4-diacetyl-2,5-dibenzamidohex-3-enedioate |
| SMILES | CCOC(=O)C(NC(=O)c1ccccc1)C(C(C)=O)=C(C(C)=O)C(NC(=O)c1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C28H30N2O8/c1-5-37-27(35)23(29-25(33)19-13-9-7-10-14-19)21(17(3)31)22(18(4)32)24(28(36)38-6-2)30-26(34)20-15-11-8-12-16-20/h7-16,23-24H,5-6H2,1-4H3,(H,29,33)(H,30,34) |
| InChIKey | XEFVFFFVNYGWCA-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 144.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.55 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|