C19H28N2O4 — CID 95782351
ethyl (2R,3S)-2-[[(3R)-3-benzamidobutanoyl]amino]-3-methylpentanoate (PubChem CID 95782351) has the molecular formula C19H28N2O4 and a molecular weight of 348.44 g/mol. Its IUPAC name is ethyl (2R,3S)-2-[[(3R)-3-benzamidobutanoyl]amino]-3-methylpentanoate.
| Compound Name | ethyl (2R,3S)-2-[[(3R)-3-benzamidobutanoyl]amino]-3-methylpentanoate |
|---|---|
| PubChem CID | 95782351 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | ethyl (2R,3S)-2-[[(3R)-3-benzamidobutanoyl]amino]-3-methylpentanoate |
| SMILES | CCOC(=O)[C@H](NC(=O)C[C@@H](C)NC(=O)c1ccccc1)[C@@H](C)CC |
| InChI | InChI=1S/C19H28N2O4/c1-5-13(3)17(19(24)25-6-2)21-16(22)12-14(4)20-18(23)15-10-8-7-9-11-15/h7-11,13-14,17H,5-6,12H2,1-4H3,(H,20,23)(H,21,22)/t13-,14+,17+/m0/s1 |
| InChIKey | OXEHYNDHPDMAHU-JJRVBVJISA-N |
| XLogP | 2.29 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |