C16H17F6NO3 — CID 132837205
1,1,1,3,3,3-hexafluoropropan-2-yl (2S)-2-benzamido-3,3-dimethylbutanoate (PubChem CID 132837205) has the molecular formula C16H17F6NO3 and a molecular weight of 385.30 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl (2S)-2-benzamido-3,3-dimethylbutanoate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl (2S)-2-benzamido-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 132837205 |
| Molecular Formula | C16H17F6NO3 |
| Molecular Weight | 385.30 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl (2S)-2-benzamido-3,3-dimethylbutanoate |
| SMILES | CC(C)(C)[C@H](NC(=O)c1ccccc1)C(=O)OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H17F6NO3/c1-14(2,3)10(23-11(24)9-7-5-4-6-8-9)12(25)26-13(15(17,18)19)16(20,21)22/h4-8,10,13H,1-3H3,(H,23,24)/t10-/m1/s1 |
| InChIKey | ZAFRVSDMAKAPAV-SNVBAGLBSA-N |
| XLogP | 3.87 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.30 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |