C13H16F3NO — CID 101120746
N-[(2R)-1,1,1-trifluoro-3,3-dimethylbutan-2-yl]benzamide (PubChem CID 101120746) has the molecular formula C13H16F3NO and a molecular weight of 259.27 g/mol. Its IUPAC name is N-[(2R)-1,1,1-trifluoro-3,3-dimethylbutan-2-yl]benzamide.
| Compound Name | N-[(2R)-1,1,1-trifluoro-3,3-dimethylbutan-2-yl]benzamide |
|---|---|
| PubChem CID | 101120746 |
| Molecular Formula | C13H16F3NO |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | N-[(2R)-1,1,1-trifluoro-3,3-dimethylbutan-2-yl]benzamide |
| SMILES | CC(C)(C)[C@@H](NC(=O)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C13H16F3NO/c1-12(2,3)11(13(14,15)16)17-10(18)9-7-5-4-6-8-9/h4-8,11H,1-3H3,(H,17,18)/t11-/m1/s1 |
| InChIKey | WGNMGBNCNDJJJP-LLVKDONJSA-N |
| XLogP | 3.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |