C12H12F3NO4 — CID 12042653
methyl 3-benzamido-4,4,4-trifluoro-2-hydroxybutanoate (PubChem CID 12042653) has the molecular formula C12H12F3NO4 and a molecular weight of 291.23 g/mol. Its IUPAC name is methyl 3-benzamido-4,4,4-trifluoro-2-hydroxybutanoate.
| Compound Name | methyl 3-benzamido-4,4,4-trifluoro-2-hydroxybutanoate |
|---|---|
| PubChem CID | 12042653 |
| Molecular Formula | C12H12F3NO4 |
| Molecular Weight | 291.23 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | methyl 3-benzamido-4,4,4-trifluoro-2-hydroxybutanoate |
| SMILES | COC(=O)C(O)C(NC(=O)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C12H12F3NO4/c1-20-11(19)8(17)9(12(13,14)15)16-10(18)7-5-3-2-4-6-7/h2-6,8-9,17H,1H3,(H,16,18) |
| InChIKey | BKALLWJNEOWTMS-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.23 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |