C12H12F3NO5S — CID 101227983
methyl (2S)-2-benzamido-3-(trifluoromethylsulfonyl)propanoate (PubChem CID 101227983) has the molecular formula C12H12F3NO5S and a molecular weight of 339.29 g/mol. Its IUPAC name is methyl (2S)-2-benzamido-3-(trifluoromethylsulfonyl)propanoate.
| Compound Name | methyl (2S)-2-benzamido-3-(trifluoromethylsulfonyl)propanoate |
|---|---|
| PubChem CID | 101227983 |
| Molecular Formula | C12H12F3NO5S |
| Molecular Weight | 339.29 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | methyl (2S)-2-benzamido-3-(trifluoromethylsulfonyl)propanoate |
| SMILES | COC(=O)[C@@H](CS(=O)(=O)C(F)(F)F)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C12H12F3NO5S/c1-21-11(18)9(7-22(19,20)12(13,14)15)16-10(17)8-5-3-2-4-6-8/h2-6,9H,7H2,1H3,(H,16,17)/t9-/m1/s1 |
| InChIKey | VUINLMISCAAXKY-SECBINFHSA-N |
| XLogP | 0.89 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.29 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |