C14H16F3NO5S — CID 101227987
methyl (2R)-2-(3-phenylpropanoylamino)-3-(trifluoromethylsulfonyl)propanoate (PubChem CID 101227987) has the molecular formula C14H16F3NO5S and a molecular weight of 367.35 g/mol. Its IUPAC name is methyl (2R)-2-(3-phenylpropanoylamino)-3-(trifluoromethylsulfonyl)propanoate.
| Compound Name | methyl (2R)-2-(3-phenylpropanoylamino)-3-(trifluoromethylsulfonyl)propanoate |
|---|---|
| PubChem CID | 101227987 |
| Molecular Formula | C14H16F3NO5S |
| Molecular Weight | 367.35 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | methyl (2R)-2-(3-phenylpropanoylamino)-3-(trifluoromethylsulfonyl)propanoate |
| SMILES | COC(=O)[C@H](CS(=O)(=O)C(F)(F)F)NC(=O)CCc1ccccc1 |
| InChI | InChI=1S/C14H16F3NO5S/c1-23-13(20)11(9-24(21,22)14(15,16)17)18-12(19)8-7-10-5-3-2-4-6-10/h2-6,11H,7-9H2,1H3,(H,18,19)/t11-/m0/s1 |
| InChIKey | DSWUPKCNHBTAPA-NSHDSACASA-N |
| XLogP | 1.21 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.35 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |