C14H19NO4 — CID 102464818
methyl (2S,3R)-3-hydroxy-2-(3-phenylpropanoylamino)butanoate (PubChem CID 102464818) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is methyl (2S,3R)-3-hydroxy-2-(3-phenylpropanoylamino)butanoate.
| Compound Name | methyl (2S,3R)-3-hydroxy-2-(3-phenylpropanoylamino)butanoate |
|---|---|
| PubChem CID | 102464818 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | methyl (2S,3R)-3-hydroxy-2-(3-phenylpropanoylamino)butanoate |
| SMILES | COC(=O)[C@@H](NC(=O)CCc1ccccc1)[C@@H](C)O |
| InChI | InChI=1S/C14H19NO4/c1-10(16)13(14(18)19-2)15-12(17)9-8-11-6-4-3-5-7-11/h3-7,10,13,16H,8-9H2,1-2H3,(H,15,17)/t10-,13+/m1/s1 |
| InChIKey | UTYXNVZLVOIZOP-MFKMUULPSA-N |
| XLogP | 0.66 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |