C16H21NO4 — CID 86978264
methyl 3-methyl-2-[(4-oxo-4-phenylbutanoyl)amino]butanoate (PubChem CID 86978264) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is methyl 3-methyl-2-[(4-oxo-4-phenylbutanoyl)amino]butanoate.
| Compound Name | methyl 3-methyl-2-[(4-oxo-4-phenylbutanoyl)amino]butanoate |
|---|---|
| PubChem CID | 86978264 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | methyl 3-methyl-2-[(4-oxo-4-phenylbutanoyl)amino]butanoate |
| SMILES | COC(=O)C(NC(=O)CCC(=O)c1ccccc1)C(C)C |
| InChI | InChI=1S/C16H21NO4/c1-11(2)15(16(20)21-3)17-14(19)10-9-13(18)12-7-5-4-6-8-12/h4-8,11,15H,9-10H2,1-3H3,(H,17,19) |
| InChIKey | WKGVNMHGGHXIDH-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |