C9H16BrNO3 — CID 25199247
methyl (2S)-2-(3-bromopropanoylamino)-3-methylbutanoate (PubChem CID 25199247) has the molecular formula C9H16BrNO3 and a molecular weight of 266.13 g/mol. Its IUPAC name is methyl (2S)-2-(3-bromopropanoylamino)-3-methylbutanoate.
| Compound Name | methyl (2S)-2-(3-bromopropanoylamino)-3-methylbutanoate |
|---|---|
| PubChem CID | 25199247 |
| Molecular Formula | C9H16BrNO3 |
| Molecular Weight | 266.13 g/mol |
| Exact Mass | 265.03 |
| IUPAC Name | methyl (2S)-2-(3-bromopropanoylamino)-3-methylbutanoate |
| SMILES | COC(=O)[C@@H](NC(=O)CCBr)C(C)C |
| InChI | InChI=1S/C9H16BrNO3/c1-6(2)8(9(13)14-3)11-7(12)4-5-10/h6,8H,4-5H2,1-3H3,(H,11,12)/t8-/m0/s1 |
| InChIKey | OXSNSEXXXQFGRV-QMMMGPOBSA-N |
| XLogP | 1.09 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.13 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|