C15H28N2O4 — CID 43422536
methyl 2-[4-(2,2-dimethylpropanoylamino)butanoylamino]-3-methylbutanoate (PubChem CID 43422536) has the molecular formula C15H28N2O4 and a molecular weight of 300.40 g/mol. Its IUPAC name is methyl 2-[4-(2,2-dimethylpropanoylamino)butanoylamino]-3-methylbutanoate.
| Compound Name | methyl 2-[4-(2,2-dimethylpropanoylamino)butanoylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 43422536 |
| Molecular Formula | C15H28N2O4 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | methyl 2-[4-(2,2-dimethylpropanoylamino)butanoylamino]-3-methylbutanoate |
| SMILES | COC(=O)C(NC(=O)CCCNC(=O)C(C)(C)C)C(C)C |
| InChI | InChI=1S/C15H28N2O4/c1-10(2)12(13(19)21-6)17-11(18)8-7-9-16-14(20)15(3,4)5/h10,12H,7-9H2,1-6H3,(H,16,20)(H,17,18) |
| InChIKey | GBQPNDAXMFKLBI-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|