C13H26N2O3 — CID 43417934
N-[4-(1-hydroxybutan-2-ylamino)-4-oxobutyl]-2,2-dimethylpropanamide (PubChem CID 43417934) has the molecular formula C13H26N2O3 and a molecular weight of 258.36 g/mol. Its IUPAC name is N-[4-(1-hydroxybutan-2-ylamino)-4-oxobutyl]-2,2-dimethylpropanamide.
| Compound Name | N-[4-(1-hydroxybutan-2-ylamino)-4-oxobutyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 43417934 |
| Molecular Formula | C13H26N2O3 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | N-[4-(1-hydroxybutan-2-ylamino)-4-oxobutyl]-2,2-dimethylpropanamide |
| SMILES | CCC(CO)NC(=O)CCCNC(=O)C(C)(C)C |
| InChI | InChI=1S/C13H26N2O3/c1-5-10(9-16)15-11(17)7-6-8-14-12(18)13(2,3)4/h10,16H,5-9H2,1-4H3,(H,14,18)(H,15,17) |
| InChIKey | SDIAJFSMFMMLIO-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|